C14H14F3NOS — CID 102675126
(1R)-1-thiophen-2-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]ethanamine (PubChem CID 102675126) has the molecular formula C14H14F3NOS and a molecular weight of 301.33 g/mol. Its IUPAC name is (1R)-1-thiophen-2-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]ethanamine.
| Compound Name | (1R)-1-thiophen-2-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 102675126 |
| Molecular Formula | C14H14F3NOS |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (1R)-1-thiophen-2-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]ethanamine |
| SMILES | C[C@@H](NCc1cccc(OC(F)(F)F)c1)c1cccs1 |
| InChI | InChI=1S/C14H14F3NOS/c1-10(13-6-3-7-20-13)18-9-11-4-2-5-12(8-11)19-14(15,16)17/h2-8,10,18H,9H2,1H3/t10-/m1/s1 |
| InChIKey | MOUONIPJDXQOGA-SNVBAGLBSA-N |
| XLogP | 4.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |