C11H14F3NO2 — CID 86814419
(2R)-1-[[3-(trifluoromethoxy)phenyl]methylamino]propan-2-ol (PubChem CID 86814419) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is (2R)-1-[[3-(trifluoromethoxy)phenyl]methylamino]propan-2-ol.
| Compound Name | (2R)-1-[[3-(trifluoromethoxy)phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 86814419 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2R)-1-[[3-(trifluoromethoxy)phenyl]methylamino]propan-2-ol |
| SMILES | C[C@@H](O)CNCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO2/c1-8(16)6-15-7-9-3-2-4-10(5-9)17-11(12,13)14/h2-5,8,15-16H,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | RDEKBXIJXBUZKT-MRVPVSSYSA-N |
| XLogP | 2.06 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |