C13H22N2O2 — CID 4721134
1-[2-[(3-methoxyphenyl)methylamino]ethylamino]propan-2-ol (PubChem CID 4721134) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[2-[(3-methoxyphenyl)methylamino]ethylamino]propan-2-ol.
| Compound Name | 1-[2-[(3-methoxyphenyl)methylamino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 4721134 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-[2-[(3-methoxyphenyl)methylamino]ethylamino]propan-2-ol |
| SMILES | COc1cccc(CNCCNCC(C)O)c1 |
| InChI | InChI=1S/C13H22N2O2/c1-11(16)9-14-6-7-15-10-12-4-3-5-13(8-12)17-2/h3-5,8,11,14-16H,6-7,9-10H2,1-2H3 |
| InChIKey | IHCGNMPHWXIIIU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|