C11H17NOS — CID 115224939
3-[(3-methoxyphenyl)methylamino]propane-1-thiol (PubChem CID 115224939) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 3-[(3-methoxyphenyl)methylamino]propane-1-thiol.
| Compound Name | 3-[(3-methoxyphenyl)methylamino]propane-1-thiol |
|---|---|
| PubChem CID | 115224939 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-[(3-methoxyphenyl)methylamino]propane-1-thiol |
| SMILES | COc1cccc(CNCCCS)c1 |
| InChI | InChI=1S/C11H17NOS/c1-13-11-5-2-4-10(8-11)9-12-6-3-7-14/h2,4-5,8,12,14H,3,6-7,9H2,1H3 |
| InChIKey | NHTRCKIMMQMJLD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|