C14H22N2O — CID 113410343
N'-cyclopropyl-N-[(3-methoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 113410343) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N'-cyclopropyl-N-[(3-methoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-cyclopropyl-N-[(3-methoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 113410343 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N'-cyclopropyl-N-[(3-methoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | COc1cccc(CNCCCNC2CC2)c1 |
| InChI | InChI=1S/C14H22N2O/c1-17-14-5-2-4-12(10-14)11-15-8-3-9-16-13-6-7-13/h2,4-5,10,13,15-16H,3,6-9,11H2,1H3 |
| InChIKey | JPYCQXLQYOJWHV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|