C13H18N2O — CID 60690756
5-[(3-methoxyphenyl)methylamino]pentanenitrile (PubChem CID 60690756) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-[(3-methoxyphenyl)methylamino]pentanenitrile.
| Compound Name | 5-[(3-methoxyphenyl)methylamino]pentanenitrile |
|---|---|
| PubChem CID | 60690756 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 5-[(3-methoxyphenyl)methylamino]pentanenitrile |
| SMILES | COc1cccc(CNCCCCC#N)c1 |
| InChI | InChI=1S/C13H18N2O/c1-16-13-7-5-6-12(10-13)11-15-9-4-2-3-8-14/h5-7,10,15H,2-4,9,11H2,1H3 |
| InChIKey | CQCWODLSUXMYJH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|