C12H16N2O — CID 60872565
3-[(3-ethoxyphenyl)methylamino]propanenitrile (PubChem CID 60872565) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-[(3-ethoxyphenyl)methylamino]propanenitrile.
| Compound Name | 3-[(3-ethoxyphenyl)methylamino]propanenitrile |
|---|---|
| PubChem CID | 60872565 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-[(3-ethoxyphenyl)methylamino]propanenitrile |
| SMILES | CCOc1cccc(CNCCC#N)c1 |
| InChI | InChI=1S/C12H16N2O/c1-2-15-12-6-3-5-11(9-12)10-14-8-4-7-13/h3,5-6,9,14H,2,4,8,10H2,1H3 |
| InChIKey | QQQDUYCQWWURES-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|