C16H31N5O — CID 69239417
N'-[2-[2-[2-[(3-methoxyphenyl)methylamino]ethylamino]ethylamino]ethyl]ethane-1,2-diamine (PubChem CID 69239417) has the molecular formula C16H31N5O and a molecular weight of 309.46 g/mol. Its IUPAC name is N'-[2-[2-[2-[(3-methoxyphenyl)methylamino]ethylamino]ethylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-[2-[(3-methoxyphenyl)methylamino]ethylamino]ethylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 69239417 |
| Molecular Formula | C16H31N5O |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | N'-[2-[2-[2-[(3-methoxyphenyl)methylamino]ethylamino]ethylamino]ethyl]ethane-1,2-diamine |
| SMILES | COc1cccc(CNCCNCCNCCNCCN)c1 |
| InChI | InChI=1S/C16H31N5O/c1-22-16-4-2-3-15(13-16)14-21-12-11-20-10-9-19-8-7-18-6-5-17/h2-4,13,18-21H,5-12,14,17H2,1H3 |
| InChIKey | FQCIHJYEPHEKPV-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|