C14H18N2O — CID 60887556
N'-[(6-methoxynaphthalen-2-yl)methyl]ethane-1,2-diamine (PubChem CID 60887556) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N'-[(6-methoxynaphthalen-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(6-methoxynaphthalen-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60887556 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N'-[(6-methoxynaphthalen-2-yl)methyl]ethane-1,2-diamine |
| SMILES | COc1ccc2cc(CNCCN)ccc2c1 |
| InChI | InChI=1S/C14H18N2O/c1-17-14-5-4-12-8-11(10-16-7-6-15)2-3-13(12)9-14/h2-5,8-9,16H,6-7,10,15H2,1H3 |
| InChIKey | OWWVDJHUAZURCF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|