C15H19NO3 — CID 66175454
3-[(6-methoxynaphthalen-2-yl)methylamino]propane-1,2-diol (PubChem CID 66175454) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-[(6-methoxynaphthalen-2-yl)methylamino]propane-1,2-diol.
| Compound Name | 3-[(6-methoxynaphthalen-2-yl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 66175454 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 3-[(6-methoxynaphthalen-2-yl)methylamino]propane-1,2-diol |
| SMILES | COc1ccc2cc(CNCC(O)CO)ccc2c1 |
| InChI | InChI=1S/C15H19NO3/c1-19-15-5-4-12-6-11(2-3-13(12)7-15)8-16-9-14(18)10-17/h2-7,14,16-18H,8-10H2,1H3 |
| InChIKey | HZYRONYVGQDPIX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |