C16H20ClNO — CID 52916342
N-[(3-methoxyphenyl)methyl]-2-phenylethanamine;hydrochloride (PubChem CID 52916342) has the molecular formula C16H20ClNO and a molecular weight of 277.80 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-2-phenylethanamine;hydrochloride.
| Compound Name | N-[(3-methoxyphenyl)methyl]-2-phenylethanamine;hydrochloride |
|---|---|
| PubChem CID | 52916342 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-2-phenylethanamine;hydrochloride |
| SMILES | COc1cccc(CNCCc2ccccc2)c1.Cl |
| InChI | InChI=1S/C16H19NO.ClH/c1-18-16-9-5-8-15(12-16)13-17-11-10-14-6-3-2-4-7-14;/h2-9,12,17H,10-11,13H2,1H3;1H |
| InChIKey | ZYTGYDICMOZSTN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|