C16H17F2NO — CID 62315705
2-(3,5-difluorophenyl)-N-[(3-methoxyphenyl)methyl]ethanamine (PubChem CID 62315705) has the molecular formula C16H17F2NO and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-[(3-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-(3,5-difluorophenyl)-N-[(3-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 62315705 |
| Molecular Formula | C16H17F2NO |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-[(3-methoxyphenyl)methyl]ethanamine |
| SMILES | COc1cccc(CNCCc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C16H17F2NO/c1-20-16-4-2-3-13(9-16)11-19-6-5-12-7-14(17)10-15(18)8-12/h2-4,7-10,19H,5-6,11H2,1H3 |
| InChIKey | OQQYLDAMHVVCOM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|