C16H19Cl2NO — CID 17208566
2-(4-chlorophenyl)-N-[(3-methoxyphenyl)methyl]ethanamine;hydrochloride (PubChem CID 17208566) has the molecular formula C16H19Cl2NO and a molecular weight of 312.24 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(3-methoxyphenyl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-N-[(3-methoxyphenyl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17208566 |
| Molecular Formula | C16H19Cl2NO |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(3-methoxyphenyl)methyl]ethanamine;hydrochloride |
| SMILES | COc1cccc(CNCCc2ccc(Cl)cc2)c1.Cl |
| InChI | InChI=1S/C16H18ClNO.ClH/c1-19-16-4-2-3-14(11-16)12-18-10-9-13-5-7-15(17)8-6-13;/h2-8,11,18H,9-10,12H2,1H3;1H |
| InChIKey | PWZSAIGWOBYFQP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|