C21H23Cl2N3O — CID 47009005
N-[[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]methyl]-2-(4-chlorophenyl)ethanamine (PubChem CID 47009005) has the molecular formula C21H23Cl2N3O and a molecular weight of 404.34 g/mol. Its IUPAC name is N-[[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]methyl]-2-(4-chlorophenyl)ethanamine.
| Compound Name | N-[[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]methyl]-2-(4-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 47009005 |
| Molecular Formula | C21H23Cl2N3O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]methyl]-2-(4-chlorophenyl)ethanamine |
| SMILES | COc1cccc(Cn2nc(C)c(CNCCc3ccc(Cl)cc3)c2Cl)c1 |
| InChI | InChI=1S/C21H23Cl2N3O/c1-15-20(13-24-11-10-16-6-8-18(22)9-7-16)21(23)26(25-15)14-17-4-3-5-19(12-17)27-2/h3-9,12,24H,10-11,13-14H2,1-2H3 |
| InChIKey | YVKBLEMMMJKTDF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|