C16H23ClFN3O — CID 126966531
N-[(1-ethyl-5-fluoro-3-methylpyrazol-4-yl)methyl]-2-(3-methoxyphenyl)ethanamine;hydrochloride (PubChem CID 126966531) has the molecular formula C16H23ClFN3O and a molecular weight of 327.83 g/mol. Its IUPAC name is N-[(1-ethyl-5-fluoro-3-methylpyrazol-4-yl)methyl]-2-(3-methoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[(1-ethyl-5-fluoro-3-methylpyrazol-4-yl)methyl]-2-(3-methoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 126966531 |
| Molecular Formula | C16H23ClFN3O |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[(1-ethyl-5-fluoro-3-methylpyrazol-4-yl)methyl]-2-(3-methoxyphenyl)ethanamine;hydrochloride |
| SMILES | CCn1nc(C)c(CNCCc2cccc(OC)c2)c1F.Cl |
| InChI | InChI=1S/C16H22FN3O.ClH/c1-4-20-16(17)15(12(2)19-20)11-18-9-8-13-6-5-7-14(10-13)21-3;/h5-7,10,18H,4,8-9,11H2,1-3H3;1H |
| InChIKey | PPHVWZHGKKXHKI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|