C16H24ClN3O — CID 126966945
2-(3-methoxyphenyl)-N-[(2-propylpyrazol-3-yl)methyl]ethanamine;hydrochloride (PubChem CID 126966945) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-[(2-propylpyrazol-3-yl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-(3-methoxyphenyl)-N-[(2-propylpyrazol-3-yl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 126966945 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-[(2-propylpyrazol-3-yl)methyl]ethanamine;hydrochloride |
| SMILES | CCCn1nccc1CNCCc1cccc(OC)c1.Cl |
| InChI | InChI=1S/C16H23N3O.ClH/c1-3-11-19-15(8-10-18-19)13-17-9-7-14-5-4-6-16(12-14)20-2;/h4-6,8,10,12,17H,3,7,9,11,13H2,1-2H3;1H |
| InChIKey | JVGOBKAJBKVYBR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|