C16H18FNO2 — CID 104878638
3-fluoro-5-[[2-(3-methoxyphenyl)ethylamino]methyl]phenol (PubChem CID 104878638) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-fluoro-5-[[2-(3-methoxyphenyl)ethylamino]methyl]phenol.
| Compound Name | 3-fluoro-5-[[2-(3-methoxyphenyl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 104878638 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-fluoro-5-[[2-(3-methoxyphenyl)ethylamino]methyl]phenol |
| SMILES | COc1cccc(CCNCc2cc(O)cc(F)c2)c1 |
| InChI | InChI=1S/C16H18FNO2/c1-20-16-4-2-3-12(9-16)5-6-18-11-13-7-14(17)10-15(19)8-13/h2-4,7-10,18-19H,5-6,11H2,1H3 |
| InChIKey | PFYCWAKHIYTURZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|