C18H25Cl2NO2 — CID 172690704
1-[(3-methoxyphenyl)methylamino]-4-phenylbutan-2-ol;dihydrochloride (PubChem CID 172690704) has the molecular formula C18H25Cl2NO2 and a molecular weight of 358.31 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methylamino]-4-phenylbutan-2-ol;dihydrochloride.
| Compound Name | 1-[(3-methoxyphenyl)methylamino]-4-phenylbutan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 172690704 |
| Molecular Formula | C18H25Cl2NO2 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-[(3-methoxyphenyl)methylamino]-4-phenylbutan-2-ol;dihydrochloride |
| SMILES | COc1cccc(CNCC(O)CCc2ccccc2)c1.Cl.Cl |
| InChI | InChI=1S/C18H23NO2.2ClH/c1-21-18-9-5-8-16(12-18)13-19-14-17(20)11-10-15-6-3-2-4-7-15;;/h2-9,12,17,19-20H,10-11,13-14H2,1H3;2*1H |
| InChIKey | BQFBTBHOULYYOL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |