C12H18INO — CID 106844685
4-iodo-N-[(3-methoxyphenyl)methyl]butan-1-amine (PubChem CID 106844685) has the molecular formula C12H18INO and a molecular weight of 319.19 g/mol. Its IUPAC name is 4-iodo-N-[(3-methoxyphenyl)methyl]butan-1-amine.
| Compound Name | 4-iodo-N-[(3-methoxyphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106844685 |
| Molecular Formula | C12H18INO |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-iodo-N-[(3-methoxyphenyl)methyl]butan-1-amine |
| SMILES | COc1cccc(CNCCCCI)c1 |
| InChI | InChI=1S/C12H18INO/c1-15-12-6-4-5-11(9-12)10-14-8-3-2-7-13/h4-6,9,14H,2-3,7-8,10H2,1H3 |
| InChIKey | HYIVRLKCFKCKRS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|