C12H12F3NO — CID 103868570
N-[[3-(trifluoromethoxy)phenyl]methyl]but-2-yn-1-amine (PubChem CID 103868570) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is N-[[3-(trifluoromethoxy)phenyl]methyl]but-2-yn-1-amine.
| Compound Name | N-[[3-(trifluoromethoxy)phenyl]methyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 103868570 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-[[3-(trifluoromethoxy)phenyl]methyl]but-2-yn-1-amine |
| SMILES | CC#CCNCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3NO/c1-2-3-7-16-9-10-5-4-6-11(8-10)17-12(13,14)15/h4-6,8,16H,7,9H2,1H3 |
| InChIKey | BGTMGZPNFHHAQP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|