C13H18F3NOS — CID 103711426
2-methyl-2-methylsulfanyl-N-[[3-(trifluoromethoxy)phenyl]methyl]propan-1-amine (PubChem CID 103711426) has the molecular formula C13H18F3NOS and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-methyl-2-methylsulfanyl-N-[[3-(trifluoromethoxy)phenyl]methyl]propan-1-amine.
| Compound Name | 2-methyl-2-methylsulfanyl-N-[[3-(trifluoromethoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103711426 |
| Molecular Formula | C13H18F3NOS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-methyl-2-methylsulfanyl-N-[[3-(trifluoromethoxy)phenyl]methyl]propan-1-amine |
| SMILES | CSC(C)(C)CNCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NOS/c1-12(2,19-3)9-17-8-10-5-4-6-11(7-10)18-13(14,15)16/h4-7,17H,8-9H2,1-3H3 |
| InChIKey | FJNDEUWJGXVTBD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |