C14H14F3NO2S — CID 103685294
1-thiophen-3-yl-2-[[3-(trifluoromethoxy)phenyl]methylamino]ethanol (PubChem CID 103685294) has the molecular formula C14H14F3NO2S and a molecular weight of 317.33 g/mol. Its IUPAC name is 1-thiophen-3-yl-2-[[3-(trifluoromethoxy)phenyl]methylamino]ethanol.
| Compound Name | 1-thiophen-3-yl-2-[[3-(trifluoromethoxy)phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 103685294 |
| Molecular Formula | C14H14F3NO2S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 1-thiophen-3-yl-2-[[3-(trifluoromethoxy)phenyl]methylamino]ethanol |
| SMILES | OC(CNCc1cccc(OC(F)(F)F)c1)c1ccsc1 |
| InChI | InChI=1S/C14H14F3NO2S/c15-14(16,17)20-12-3-1-2-10(6-12)7-18-8-13(19)11-4-5-21-9-11/h1-6,9,13,18-19H,7-8H2 |
| InChIKey | RXNBUGYQDWTFTR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |