C14H13F4NOS — CID 103823528
2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-1-thiophen-3-ylethanol (PubChem CID 103823528) has the molecular formula C14H13F4NOS and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 103823528 |
| Molecular Formula | C14H13F4NOS |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]-1-thiophen-3-ylethanol |
| SMILES | OC(CNCc1cc(F)cc(C(F)(F)F)c1)c1ccsc1 |
| InChI | InChI=1S/C14H13F4NOS/c15-12-4-9(3-11(5-12)14(16,17)18)6-19-7-13(20)10-1-2-21-8-10/h1-5,8,13,19-20H,6-7H2 |
| InChIKey | YJYHNPBUBGPHFT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |