C16H23NOSSi — CID 106435058
1-thiophen-3-yl-2-[(4-trimethylsilylphenyl)methylamino]ethanol (PubChem CID 106435058) has the molecular formula C16H23NOSSi and a molecular weight of 305.52 g/mol. Its IUPAC name is 1-thiophen-3-yl-2-[(4-trimethylsilylphenyl)methylamino]ethanol.
| Compound Name | 1-thiophen-3-yl-2-[(4-trimethylsilylphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 106435058 |
| Molecular Formula | C16H23NOSSi |
| Molecular Weight | 305.52 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-thiophen-3-yl-2-[(4-trimethylsilylphenyl)methylamino]ethanol |
| SMILES | C[Si](C)(C)c1ccc(CNCC(O)c2ccsc2)cc1 |
| InChI | InChI=1S/C16H23NOSSi/c1-20(2,3)15-6-4-13(5-7-15)10-17-11-16(18)14-8-9-19-12-14/h4-9,12,16-18H,10-11H2,1-3H3 |
| InChIKey | ZTBFAXVATZXKHD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|