C9H15NO2S — CID 106435263
(2S)-1-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propan-2-ol (PubChem CID 106435263) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is (2S)-1-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propan-2-ol.
| Compound Name | (2S)-1-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 106435263 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (2S)-1-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propan-2-ol |
| SMILES | C[C@H](O)CNCC(O)c1ccsc1 |
| InChI | InChI=1S/C9H15NO2S/c1-7(11)4-10-5-9(12)8-2-3-13-6-8/h2-3,6-7,9-12H,4-5H2,1H3/t7-,9?/m0/s1 |
| InChIKey | GYNGTTWHVOWZKK-JAVCKPHESA-N |
| XLogP | 0.75 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |