C10H15NO3S — CID 106435089
methyl 3-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propanoate (PubChem CID 106435089) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is methyl 3-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propanoate.
| Compound Name | methyl 3-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propanoate |
|---|---|
| PubChem CID | 106435089 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | methyl 3-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propanoate |
| SMILES | COC(=O)CCNCC(O)c1ccsc1 |
| InChI | InChI=1S/C10H15NO3S/c1-14-10(13)2-4-11-6-9(12)8-3-5-15-7-8/h3,5,7,9,11-12H,2,4,6H2,1H3 |
| InChIKey | UTNCLAAFQVWWJC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|