C13H23NO3S — CID 106434954
2-(3,3-diethoxypropylamino)-1-thiophen-3-ylethanol (PubChem CID 106434954) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-(3,3-diethoxypropylamino)-1-thiophen-3-ylethanol.
| Compound Name | 2-(3,3-diethoxypropylamino)-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106434954 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-(3,3-diethoxypropylamino)-1-thiophen-3-ylethanol |
| SMILES | CCOC(CCNCC(O)c1ccsc1)OCC |
| InChI | InChI=1S/C13H23NO3S/c1-3-16-13(17-4-2)5-7-14-9-12(15)11-6-8-18-10-11/h6,8,10,12-15H,3-5,7,9H2,1-2H3 |
| InChIKey | TYAIOYKQEIJKKK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|