C10H15NO3S — CID 106434937
propan-2-yl N-(2-hydroxy-2-thiophen-3-ylethyl)carbamate (PubChem CID 106434937) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is propan-2-yl N-(2-hydroxy-2-thiophen-3-ylethyl)carbamate.
| Compound Name | propan-2-yl N-(2-hydroxy-2-thiophen-3-ylethyl)carbamate |
|---|---|
| PubChem CID | 106434937 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | propan-2-yl N-(2-hydroxy-2-thiophen-3-ylethyl)carbamate |
| SMILES | CC(C)OC(=O)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C10H15NO3S/c1-7(2)14-10(13)11-5-9(12)8-3-4-15-6-8/h3-4,6-7,9,12H,5H2,1-2H3,(H,11,13) |
| InChIKey | LWVASXFLVLLYTK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |