C11H16N2O3S — CID 90496631
N'-(2-hydroxy-2-thiophen-3-ylethyl)-N-propyloxamide (PubChem CID 90496631) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N'-(2-hydroxy-2-thiophen-3-ylethyl)-N-propyloxamide.
| Compound Name | N'-(2-hydroxy-2-thiophen-3-ylethyl)-N-propyloxamide |
|---|---|
| PubChem CID | 90496631 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N'-(2-hydroxy-2-thiophen-3-ylethyl)-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C11H16N2O3S/c1-2-4-12-10(15)11(16)13-6-9(14)8-3-5-17-7-8/h3,5,7,9,14H,2,4,6H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | PHGSGXSLTUIRLF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|