C10H14N2O3S — CID 121132255
N'-(3-hydroxy-3-thiophen-3-ylpropyl)-N-methyloxamide (PubChem CID 121132255) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is N'-(3-hydroxy-3-thiophen-3-ylpropyl)-N-methyloxamide.
| Compound Name | N'-(3-hydroxy-3-thiophen-3-ylpropyl)-N-methyloxamide |
|---|---|
| PubChem CID | 121132255 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N'-(3-hydroxy-3-thiophen-3-ylpropyl)-N-methyloxamide |
| SMILES | CNC(=O)C(=O)NCCC(O)c1ccsc1 |
| InChI | InChI=1S/C10H14N2O3S/c1-11-9(14)10(15)12-4-2-8(13)7-3-5-16-6-7/h3,5-6,8,13H,2,4H2,1H3,(H,11,14)(H,12,15) |
| InChIKey | XPWYPSMSPDQUGG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|