C17H20N2O4S — CID 121132291
N'-(4-ethoxyphenyl)-N-(3-hydroxy-3-thiophen-3-ylpropyl)oxamide (PubChem CID 121132291) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N'-(4-ethoxyphenyl)-N-(3-hydroxy-3-thiophen-3-ylpropyl)oxamide.
| Compound Name | N'-(4-ethoxyphenyl)-N-(3-hydroxy-3-thiophen-3-ylpropyl)oxamide |
|---|---|
| PubChem CID | 121132291 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N'-(4-ethoxyphenyl)-N-(3-hydroxy-3-thiophen-3-ylpropyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)NCCC(O)c2ccsc2)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-2-23-14-5-3-13(4-6-14)19-17(22)16(21)18-9-7-15(20)12-8-10-24-11-12/h3-6,8,10-11,15,20H,2,7,9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | ARAODZWUMATPGK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|