C17H20N2O3S — CID 90496666
N-(2-hydroxy-2-thiophen-3-ylethyl)-N'-(2,4,6-trimethylphenyl)oxamide (PubChem CID 90496666) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-N'-(2,4,6-trimethylphenyl)oxamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-N'-(2,4,6-trimethylphenyl)oxamide |
|---|---|
| PubChem CID | 90496666 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-N'-(2,4,6-trimethylphenyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)NCC(O)c2ccsc2)c(C)c1 |
| InChI | InChI=1S/C17H20N2O3S/c1-10-6-11(2)15(12(3)7-10)19-17(22)16(21)18-8-14(20)13-4-5-23-9-13/h4-7,9,14,20H,8H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | SWZZDDKTNHTGKX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|