C15H16N2O3S — CID 90496639
N-(2-hydroxy-2-thiophen-3-ylethyl)-N'-(2-methylphenyl)oxamide (PubChem CID 90496639) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-N'-(2-methylphenyl)oxamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 90496639 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-N'-(2-methylphenyl)oxamide |
| SMILES | Cc1ccccc1NC(=O)C(=O)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C15H16N2O3S/c1-10-4-2-3-5-12(10)17-15(20)14(19)16-8-13(18)11-6-7-21-9-11/h2-7,9,13,18H,8H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | VMZNROYQJSTCMW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|