C21H27N3O2S — CID 16932603
N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-(2-methylphenyl)oxamide (PubChem CID 16932603) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-(2-methylphenyl)oxamide.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 16932603 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-(2-methylphenyl)oxamide |
| SMILES | Cc1ccccc1NC(=O)C(=O)NCC(c1ccsc1)N1CCCCCC1 |
| InChI | InChI=1S/C21H27N3O2S/c1-16-8-4-5-9-18(16)23-21(26)20(25)22-14-19(17-10-13-27-15-17)24-11-6-2-3-7-12-24/h4-5,8-10,13,15,19H,2-3,6-7,11-12,14H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | ZAGOOZWFWDZAHC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|