C17H27N3O2S — CID 16932587
N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-propan-2-yloxamide (PubChem CID 16932587) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-propan-2-yloxamide.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 16932587 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NCC(c1ccsc1)N1CCCCCC1 |
| InChI | InChI=1S/C17H27N3O2S/c1-13(2)19-17(22)16(21)18-11-15(14-7-10-23-12-14)20-8-5-3-4-6-9-20/h7,10,12-13,15H,3-6,8-9,11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | JRTXBIOOTAGKPP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|