C20H24ClN3O2S — CID 16932602
N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-(2-chlorophenyl)oxamide (PubChem CID 16932602) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-(2-chlorophenyl)oxamide.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-(2-chlorophenyl)oxamide |
|---|---|
| PubChem CID | 16932602 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-N'-(2-chlorophenyl)oxamide |
| SMILES | O=C(NCC(c1ccsc1)N1CCCCCC1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C20H24ClN3O2S/c21-16-7-3-4-8-17(16)23-20(26)19(25)22-13-18(15-9-12-27-14-15)24-10-5-1-2-6-11-24/h3-4,7-9,12,14,18H,1-2,5-6,10-11,13H2,(H,22,25)(H,23,26) |
| InChIKey | CSSQHNFTRYRKOA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|