C20H24ClN3O2S — CID 16932218
N-[(2-chlorophenyl)methyl]-N'-(2-piperidin-1-yl-2-thiophen-3-ylethyl)oxamide (PubChem CID 16932218) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N'-(2-piperidin-1-yl-2-thiophen-3-ylethyl)oxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N'-(2-piperidin-1-yl-2-thiophen-3-ylethyl)oxamide |
|---|---|
| PubChem CID | 16932218 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N'-(2-piperidin-1-yl-2-thiophen-3-ylethyl)oxamide |
| SMILES | O=C(NCc1ccccc1Cl)C(=O)NCC(c1ccsc1)N1CCCCC1 |
| InChI | InChI=1S/C20H24ClN3O2S/c21-17-7-3-2-6-15(17)12-22-19(25)20(26)23-13-18(16-8-11-27-14-16)24-9-4-1-5-10-24/h2-3,6-8,11,14,18H,1,4-5,9-10,12-13H2,(H,22,25)(H,23,26) |
| InChIKey | LNSIDTXNORGICY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|