C20H25N3O3S — CID 16932512
N'-(2,5-dimethylphenyl)-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide (PubChem CID 16932512) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is N'-(2,5-dimethylphenyl)-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide.
| Compound Name | N'-(2,5-dimethylphenyl)-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide |
|---|---|
| PubChem CID | 16932512 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N'-(2,5-dimethylphenyl)-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=O)NCC(c2ccsc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H25N3O3S/c1-14-3-4-15(2)17(11-14)22-20(25)19(24)21-12-18(16-5-10-27-13-16)23-6-8-26-9-7-23/h3-5,10-11,13,18H,6-9,12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | PZJDUSNPCLTGKM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|