C17H27N3O3S — CID 16932439
N-(3-methylbutyl)-N'-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide (PubChem CID 16932439) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is N-(3-methylbutyl)-N'-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide.
| Compound Name | N-(3-methylbutyl)-N'-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide |
|---|---|
| PubChem CID | 16932439 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-(3-methylbutyl)-N'-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide |
| SMILES | CC(C)CCNC(=O)C(=O)NCC(c1ccsc1)N1CCOCC1 |
| InChI | InChI=1S/C17H27N3O3S/c1-13(2)3-5-18-16(21)17(22)19-11-15(14-4-10-24-12-14)20-6-8-23-9-7-20/h4,10,12-13,15H,3,5-9,11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | AJOFTPHLRCPNQU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|