C18H27N3O3S — CID 16932444
N'-cyclohexyl-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide (PubChem CID 16932444) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N'-cyclohexyl-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide.
| Compound Name | N'-cyclohexyl-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide |
|---|---|
| PubChem CID | 16932444 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N'-cyclohexyl-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)oxamide |
| SMILES | O=C(NCC(c1ccsc1)N1CCOCC1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H27N3O3S/c22-17(18(23)20-15-4-2-1-3-5-15)19-12-16(14-6-11-25-13-14)21-7-9-24-10-8-21/h6,11,13,15-16H,1-5,7-10,12H2,(H,19,22)(H,20,23) |
| InChIKey | HDCDZSGTYNZULB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|