C21H20N2O3 — CID 111111436
N-(2-hydroxy-2-naphthalen-2-ylethyl)-N'-(2-methylphenyl)oxamide (PubChem CID 111111436) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(2-hydroxy-2-naphthalen-2-ylethyl)-N'-(2-methylphenyl)oxamide.
| Compound Name | N-(2-hydroxy-2-naphthalen-2-ylethyl)-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 111111436 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(2-hydroxy-2-naphthalen-2-ylethyl)-N'-(2-methylphenyl)oxamide |
| SMILES | Cc1ccccc1NC(=O)C(=O)NCC(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H20N2O3/c1-14-6-2-5-9-18(14)23-21(26)20(25)22-13-19(24)17-11-10-15-7-3-4-8-16(15)12-17/h2-12,19,24H,13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | LURFWTHWQYSCCK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|