C20H18F3N3O3 — CID 121180021
N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]-N'-[2-(trifluoromethyl)phenyl]oxamide (PubChem CID 121180021) has the molecular formula C20H18F3N3O3 and a molecular weight of 405.38 g/mol. Its IUPAC name is N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]-N'-[2-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]-N'-[2-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 121180021 |
| Molecular Formula | C20H18F3N3O3 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]-N'-[2-(trifluoromethyl)phenyl]oxamide |
| SMILES | Cn1ccc2cc(C(O)CNC(=O)C(=O)Nc3ccccc3C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H18F3N3O3/c1-26-9-8-12-10-13(6-7-16(12)26)17(27)11-24-18(28)19(29)25-15-5-3-2-4-14(15)20(21,22)23/h2-10,17,27H,11H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | IYNSPEYSDDANON-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|