C18H16F2N2O2 — CID 124843487
2,6-difluoro-N-[(2S)-2-hydroxy-2-(1-methylindol-5-yl)ethyl]benzamide (PubChem CID 124843487) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is 2,6-difluoro-N-[(2S)-2-hydroxy-2-(1-methylindol-5-yl)ethyl]benzamide.
| Compound Name | 2,6-difluoro-N-[(2S)-2-hydroxy-2-(1-methylindol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 124843487 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2,6-difluoro-N-[(2S)-2-hydroxy-2-(1-methylindol-5-yl)ethyl]benzamide |
| SMILES | Cn1ccc2cc([C@H](O)CNC(=O)c3c(F)cccc3F)ccc21 |
| InChI | InChI=1S/C18H16F2N2O2/c1-22-8-7-11-9-12(5-6-15(11)22)16(23)10-21-18(24)17-13(19)3-2-4-14(17)20/h2-9,16,23H,10H2,1H3,(H,21,24)/t16-/m1/s1 |
| InChIKey | DUYRUNNNAFMLHL-MRXNPFEDSA-N |
| XLogP | 2.92 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |