C18H16BrClN2O2 — CID 121179831
5-bromo-2-chloro-N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]benzamide (PubChem CID 121179831) has the molecular formula C18H16BrClN2O2 and a molecular weight of 407.70 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 121179831 |
| Molecular Formula | C18H16BrClN2O2 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 5-bromo-2-chloro-N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]benzamide |
| SMILES | Cn1ccc2cc(C(O)CNC(=O)c3cc(Br)ccc3Cl)ccc21 |
| InChI | InChI=1S/C18H16BrClN2O2/c1-22-7-6-11-8-12(2-5-16(11)22)17(23)10-21-18(24)14-9-13(19)3-4-15(14)20/h2-9,17,23H,10H2,1H3,(H,21,24) |
| InChIKey | YMWPCYOQJOLPPP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |