C18H17IN2O2 — CID 121179834
N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]-2-iodobenzamide (PubChem CID 121179834) has the molecular formula C18H17IN2O2 and a molecular weight of 420.25 g/mol. Its IUPAC name is N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]-2-iodobenzamide.
| Compound Name | N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 121179834 |
| Molecular Formula | C18H17IN2O2 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | N-[2-hydroxy-2-(1-methylindol-5-yl)ethyl]-2-iodobenzamide |
| SMILES | Cn1ccc2cc(C(O)CNC(=O)c3ccccc3I)ccc21 |
| InChI | InChI=1S/C18H17IN2O2/c1-21-9-8-12-10-13(6-7-16(12)21)17(22)11-20-18(23)14-4-2-3-5-15(14)19/h2-10,17,22H,11H2,1H3,(H,20,23) |
| InChIKey | YQAVMOMNTMEZSX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|