C19H22N2O6 — CID 90613594
N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N'-(2-methoxyphenyl)oxamide (PubChem CID 90613594) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N'-(2-methoxyphenyl)oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N'-(2-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 90613594 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N'-(2-methoxyphenyl)oxamide |
| SMILES | COc1ccccc1NC(=O)C(=O)NCC(O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O6/c1-25-15-7-5-4-6-13(15)21-19(24)18(23)20-11-14(22)12-8-9-16(26-2)17(10-12)27-3/h4-10,14,22H,11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | RMEIUXGTCFNGTI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|