C18H18F2N2O5 — CID 90613602
N'-(2,5-difluorophenyl)-N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide (PubChem CID 90613602) has the molecular formula C18H18F2N2O5 and a molecular weight of 380.35 g/mol. Its IUPAC name is N'-(2,5-difluorophenyl)-N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide.
| Compound Name | N'-(2,5-difluorophenyl)-N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide |
|---|---|
| PubChem CID | 90613602 |
| Molecular Formula | C18H18F2N2O5 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N'-(2,5-difluorophenyl)-N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide |
| SMILES | COc1ccc(C(O)CNC(=O)C(=O)Nc2cc(F)ccc2F)cc1OC |
| InChI | InChI=1S/C18H18F2N2O5/c1-26-15-6-3-10(7-16(15)27-2)14(23)9-21-17(24)18(25)22-13-8-11(19)4-5-12(13)20/h3-8,14,23H,9H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | JFCGEYXAWGSDJN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|