C20H23N3O6 — CID 90613622
N'-(4-acetamidophenyl)-N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide (PubChem CID 90613622) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is N'-(4-acetamidophenyl)-N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide.
| Compound Name | N'-(4-acetamidophenyl)-N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide |
|---|---|
| PubChem CID | 90613622 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N'-(4-acetamidophenyl)-N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide |
| SMILES | COc1ccc(C(O)CNC(=O)C(=O)Nc2ccc(NC(C)=O)cc2)cc1OC |
| InChI | InChI=1S/C20H23N3O6/c1-12(24)22-14-5-7-15(8-6-14)23-20(27)19(26)21-11-16(25)13-4-9-17(28-2)18(10-13)29-3/h4-10,16,25H,11H2,1-3H3,(H,21,26)(H,22,24)(H,23,27) |
| InChIKey | ZDDWDGWKHLRKEB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|