C14H22N2O4 — CID 82314341
N-[2-[[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]amino]ethyl]acetamide (PubChem CID 82314341) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[2-[[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 82314341 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-[2-[[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]amino]ethyl]acetamide |
| SMILES | COc1ccc(C(O)CNCCNC(C)=O)cc1OC |
| InChI | InChI=1S/C14H22N2O4/c1-10(17)16-7-6-15-9-12(18)11-4-5-13(19-2)14(8-11)20-3/h4-5,8,12,15,18H,6-7,9H2,1-3H3,(H,16,17) |
| InChIKey | LHVHMUSDQMXJPB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|