C19H18F3N3O4 — CID 90534917
N'-(4-acetamidophenyl)-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]oxamide (PubChem CID 90534917) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is N'-(4-acetamidophenyl)-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]oxamide.
| Compound Name | N'-(4-acetamidophenyl)-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]oxamide |
|---|---|
| PubChem CID | 90534917 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N'-(4-acetamidophenyl)-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]oxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(=O)NCC(O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H18F3N3O4/c1-11(26)24-14-6-8-15(9-7-14)25-18(29)17(28)23-10-16(27)12-2-4-13(5-3-12)19(20,21)22/h2-9,16,27H,10H2,1H3,(H,23,28)(H,24,26)(H,25,29) |
| InChIKey | GDMDYVVCRMFLRZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|